methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate

C16H24N2O2 — CID 62879745

IUPACmethyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate
SMILESCOC(=O)C(CCc1ccccc1)N1CCCNCC1
InChIInChI=1S/C16H24N2O2/c1-20-16(19)15(18-12-5-10-17-11-13-18)9-8-14-6-3-2-4-7-14/h2-4,6-7,15,17H,5,8-13H2,1H3
InChIKeyQPQQEXQLJVBMNM-UHFFFAOYSA-N
MW276.38 g/mol
LogP1.46
Rot. Bonds5

About methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate

methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate (PubChem CID 62879745) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate.

Molecular Properties

Compound Namemethyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate
PubChem CID62879745
Molecular FormulaC16H24N2O2
Molecular Weight276.38 g/mol
Exact Mass276.18
IUPAC Namemethyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate
SMILESCOC(=O)C(CCc1ccccc1)N1CCCNCC1
InChIInChI=1S/C16H24N2O2/c1-20-16(19)15(18-12-5-10-17-11-13-18)9-8-14-6-3-2-4-7-14/h2-4,6-7,15,17H,5,8-13H2,1H3
InChIKeyQPQQEXQLJVBMNM-UHFFFAOYSA-N
XLogP1.46
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.38
LogP ≤ 51.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate?
The IUPAC name of methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate (CID 62879745) is methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate.
What is the SMILES notation for methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate?
The canonical SMILES for methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate is COC(=O)C(CCc1ccccc1)N1CCCNCC1.
What is the InChIKey of methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate?
The InChIKey is QPQQEXQLJVBMNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-20-16(19)15(18-12-5-10-17-11-13-18)9-8-14-6-3-2-4-7-14/h2-4,6-7,15,17H,5,8-13H2,1H3.
What are the key properties of methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate?
methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate has a molecular weight of 276.38 g/mol, XLogP of 1.46, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,4-diazepan-1-yl)-4-phenylbutanoate is sourced from PubChem (CID 62879745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).