C14H19NO2 — CID 20833938
methyl 3-phenyl-2-pyrrolidin-1-ylpropanoate (PubChem CID 20833938) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is methyl 3-phenyl-2-pyrrolidin-1-ylpropanoate.
| Compound Name | methyl 3-phenyl-2-pyrrolidin-1-ylpropanoate |
|---|---|
| PubChem CID | 20833938 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | methyl 3-phenyl-2-pyrrolidin-1-ylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C14H19NO2/c1-17-14(16)13(15-9-5-6-10-15)11-12-7-3-2-4-8-12/h2-4,7-8,13H,5-6,9-11H2,1H3 |
| InChIKey | LFYAUPWNCDWLCJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |