C14H19NO4S — CID 3288684
methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-phenylpropanoate (PubChem CID 3288684) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-phenylpropanoate.
| Compound Name | methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 3288684 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H19NO4S/c1-19-14(16)13(11-12-5-3-2-4-6-12)15-7-9-20(17,18)10-8-15/h2-6,13H,7-11H2,1H3 |
| InChIKey | NZONWRGGRSQSHI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |