C13H15ClNO3P — CID 22094967
methyl 2-(2-chloro-2-oxo-5H-1,2λ5-azaphosphol-1-yl)-3-phenylpropanoate (PubChem CID 22094967) has the molecular formula C13H15ClNO3P and a molecular weight of 299.69 g/mol. Its IUPAC name is methyl 2-(2-chloro-2-oxo-5H-1,2λ5-azaphosphol-1-yl)-3-phenylpropanoate.
| Compound Name | methyl 2-(2-chloro-2-oxo-5H-1,2λ5-azaphosphol-1-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 22094967 |
| Molecular Formula | C13H15ClNO3P |
| Molecular Weight | 299.69 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | methyl 2-(2-chloro-2-oxo-5H-1,2λ5-azaphosphol-1-yl)-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)N1CC=CP1(=O)Cl |
| InChI | InChI=1S/C13H15ClNO3P/c1-18-13(16)12(10-11-6-3-2-4-7-11)15-8-5-9-19(15,14)17/h2-7,9,12H,8,10H2,1H3 |
| InChIKey | ZWAZKWYRSVBXCB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.69 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|