C20H23NO2S — CID 87899013
methyl 2-[(2S)-2-(benzylsulfanylmethyl)aziridin-1-yl]-3-phenylpropanoate (PubChem CID 87899013) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is methyl 2-[(2S)-2-(benzylsulfanylmethyl)aziridin-1-yl]-3-phenylpropanoate.
| Compound Name | methyl 2-[(2S)-2-(benzylsulfanylmethyl)aziridin-1-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 87899013 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | methyl 2-[(2S)-2-(benzylsulfanylmethyl)aziridin-1-yl]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)N1C[C@H]1CSCc1ccccc1 |
| InChI | InChI=1S/C20H23NO2S/c1-23-20(22)19(12-16-8-4-2-5-9-16)21-13-18(21)15-24-14-17-10-6-3-7-11-17/h2-11,18-19H,12-15H2,1H3/t18-,19?,21?/m0/s1 |
| InChIKey | VLQBBJIFXOTGQD-JSOIOWGOSA-N |
| XLogP | 3.39 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|