C15H18BrNO3 — CID 168503334
methyl (2R)-2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-3-phenylpropanoate (PubChem CID 168503334) has the molecular formula C15H18BrNO3 and a molecular weight of 340.22 g/mol. Its IUPAC name is methyl (2R)-2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 168503334 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | methyl (2R)-2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)N1CC(CBr)CC1=O |
| InChI | InChI=1S/C15H18BrNO3/c1-20-15(19)13(7-11-5-3-2-4-6-11)17-10-12(9-16)8-14(17)18/h2-6,12-13H,7-10H2,1H3/t12?,13-/m1/s1 |
| InChIKey | XLZHPCZXIMIIQI-ZGTCLIOFSA-N |
| XLogP | 2.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|