C15H18BrNO4 — CID 168503157
(2S,3R)-3-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-2-hydroxy-4-phenylbutanoic acid (PubChem CID 168503157) has the molecular formula C15H18BrNO4 and a molecular weight of 356.22 g/mol. Its IUPAC name is (2S,3R)-3-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-2-hydroxy-4-phenylbutanoic acid.
| Compound Name | (2S,3R)-3-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-2-hydroxy-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 168503157 |
| Molecular Formula | C15H18BrNO4 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | (2S,3R)-3-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-2-hydroxy-4-phenylbutanoic acid |
| SMILES | O=C(O)[C@@H](O)[C@@H](Cc1ccccc1)N1CC(CBr)CC1=O |
| InChI | InChI=1S/C15H18BrNO4/c16-8-11-7-13(18)17(9-11)12(14(19)15(20)21)6-10-4-2-1-3-5-10/h1-5,11-12,14,19H,6-9H2,(H,20,21)/t11?,12-,14+/m1/s1 |
| InChIKey | UKTUEMOIJDLVJX-AOUZGSJDSA-N |
| XLogP | 1.29 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|