C15H18FNO5S — CID 168674837
methyl (2R)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-phenylpropanoate (PubChem CID 168674837) has the molecular formula C15H18FNO5S and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl (2R)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 168674837 |
| Molecular Formula | C15H18FNO5S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | methyl (2R)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C15H18FNO5S/c1-22-15(19)13(7-11-5-3-2-4-6-11)17-9-12(8-14(17)18)10-23(16,20)21/h2-6,12-13H,7-10H2,1H3/t12?,13-/m1/s1 |
| InChIKey | INXKJUXRHSICGD-ZGTCLIOFSA-N |
| XLogP | 0.92 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |