methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate

C14H17NO2 — CID 135574815

IUPACmethyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate
SMILESCOC(=O)[C@@H](Cc1ccccc1)N1CC=CC1
InChIInChI=1S/C14H17NO2/c1-17-14(16)13(15-9-5-6-10-15)11-12-7-3-2-4-8-12/h2-8,13H,9-11H2,1H3/t13-/m1/s1
InChIKeyLJVKDKHSQICJFR-CYBMUJFWSA-N
MW231.30 g/mol
LogP1.64
Rot. Bonds4

About methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate

methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate (PubChem CID 135574815) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate.

Molecular Properties

Compound Namemethyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate
PubChem CID135574815
Molecular FormulaC14H17NO2
Molecular Weight231.30 g/mol
Exact Mass231.13
IUPAC Namemethyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate
SMILESCOC(=O)[C@@H](Cc1ccccc1)N1CC=CC1
InChIInChI=1S/C14H17NO2/c1-17-14(16)13(15-9-5-6-10-15)11-12-7-3-2-4-8-12/h2-8,13H,9-11H2,1H3/t13-/m1/s1
InChIKeyLJVKDKHSQICJFR-CYBMUJFWSA-N
XLogP1.64
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.30
LogP ≤ 51.64
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate?
The IUPAC name of methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate (CID 135574815) is methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate.
What is the SMILES notation for methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate?
The canonical SMILES for methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate is COC(=O)[C@@H](Cc1ccccc1)N1CC=CC1.
What is the InChIKey of methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate?
The InChIKey is LJVKDKHSQICJFR-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H17NO2/c1-17-14(16)13(15-9-5-6-10-15)11-12-7-3-2-4-8-12/h2-8,13H,9-11H2,1H3/t13-/m1/s1.
What are the key properties of methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate?
methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate has a molecular weight of 231.30 g/mol, XLogP of 1.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-(2,5-dihydropyrrol-1-yl)-3-phenylpropanoate is sourced from PubChem (CID 135574815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).