C20H24NO5P — CID 86585562
methyl (2R)-2-[2-(4-methoxyphenyl)-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-3-phenylpropanoate (PubChem CID 86585562) has the molecular formula C20H24NO5P and a molecular weight of 389.39 g/mol. Its IUPAC name is methyl (2R)-2-[2-(4-methoxyphenyl)-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[2-(4-methoxyphenyl)-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 86585562 |
| Molecular Formula | C20H24NO5P |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl (2R)-2-[2-(4-methoxyphenyl)-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)N1CCCOP1(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H24NO5P/c1-24-17-9-11-18(12-10-17)27(23)21(13-6-14-26-27)19(20(22)25-2)15-16-7-4-3-5-8-16/h3-5,7-12,19H,6,13-15H2,1-2H3 |
| InChIKey | WUKRWVUBABCIKZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|