C17H26NO5P — CID 91115333
methyl (2R)-2-[2-(4-methoxyphenyl)-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-4-methylpentanoate (PubChem CID 91115333) has the molecular formula C17H26NO5P and a molecular weight of 355.37 g/mol. Its IUPAC name is methyl (2R)-2-[2-(4-methoxyphenyl)-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[2-(4-methoxyphenyl)-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 91115333 |
| Molecular Formula | C17H26NO5P |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | methyl (2R)-2-[2-(4-methoxyphenyl)-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)N1CCCOP1(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H26NO5P/c1-13(2)12-16(17(19)22-4)18-10-5-11-23-24(18,20)15-8-6-14(21-3)7-9-15/h6-9,13,16H,5,10-12H2,1-4H3/t16-,24?/m1/s1 |
| InChIKey | CUKRBDLYUQUGSM-YAOANENCSA-N |
| XLogP | 2.82 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|