C12H16NO4P — CID 70021183
2-[2-(4-methoxyphenyl)-2-oxo-1,2λ5-azaphospholidin-1-yl]acetic acid (PubChem CID 70021183) has the molecular formula C12H16NO4P and a molecular weight of 269.24 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)-2-oxo-1,2λ5-azaphospholidin-1-yl]acetic acid.
| Compound Name | 2-[2-(4-methoxyphenyl)-2-oxo-1,2λ5-azaphospholidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 70021183 |
| Molecular Formula | C12H16NO4P |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)-2-oxo-1,2λ5-azaphospholidin-1-yl]acetic acid |
| SMILES | COc1ccc(P2(=O)CCCN2CC(=O)O)cc1 |
| InChI | InChI=1S/C12H16NO4P/c1-17-10-3-5-11(6-4-10)18(16)8-2-7-13(18)9-12(14)15/h3-6H,2,7-9H2,1H3,(H,14,15) |
| InChIKey | YEURSYZOKINWDR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|