C16H23NO5P- — CID 22677687
2-[2-(4-methoxyphenyl)-2-oxo-4-propan-2-yl-1,3,2λ5-oxazaphosphepan-3-yl]acetate (PubChem CID 22677687) has the molecular formula C16H23NO5P- and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)-2-oxo-4-propan-2-yl-1,3,2λ5-oxazaphosphepan-3-yl]acetate.
| Compound Name | 2-[2-(4-methoxyphenyl)-2-oxo-4-propan-2-yl-1,3,2λ5-oxazaphosphepan-3-yl]acetate |
|---|---|
| PubChem CID | 22677687 |
| Molecular Formula | C16H23NO5P- |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)-2-oxo-4-propan-2-yl-1,3,2λ5-oxazaphosphepan-3-yl]acetate |
| SMILES | COc1ccc(P2(=O)OCCCC(C(C)C)N2CC(=O)[O-])cc1 |
| InChI | InChI=1S/C16H24NO5P/c1-12(2)15-5-4-10-22-23(20,17(15)11-16(18)19)14-8-6-13(21-3)7-9-14/h6-9,12,15H,4-5,10-11H2,1-3H3,(H,18,19)/p-1 |
| InChIKey | SBLDFNLHGFCGLI-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|