C21H26NO6P — CID 10216471
ethyl 2-[2,4-bis(4-methoxyphenyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-3-yl]acetate (PubChem CID 10216471) has the molecular formula C21H26NO6P and a molecular weight of 419.41 g/mol. Its IUPAC name is ethyl 2-[2,4-bis(4-methoxyphenyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-3-yl]acetate.
| Compound Name | ethyl 2-[2,4-bis(4-methoxyphenyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-3-yl]acetate |
|---|---|
| PubChem CID | 10216471 |
| Molecular Formula | C21H26NO6P |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | ethyl 2-[2,4-bis(4-methoxyphenyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(c2ccc(OC)cc2)CCOP1(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H26NO6P/c1-4-27-21(23)15-22-20(16-5-7-17(25-2)8-6-16)13-14-28-29(22,24)19-11-9-18(26-3)10-12-19/h5-12,20H,4,13-15H2,1-3H3 |
| InChIKey | NRHNFWHTZQQOKV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|