C20H28N2O4 — CID 86842837
ethyl 2-[cyclopropyl-[2-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]amino]acetate (PubChem CID 86842837) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is ethyl 2-[cyclopropyl-[2-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]amino]acetate.
| Compound Name | ethyl 2-[cyclopropyl-[2-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]amino]acetate |
|---|---|
| PubChem CID | 86842837 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | ethyl 2-[cyclopropyl-[2-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]amino]acetate |
| SMILES | CCOC(=O)CN(CC(=O)N1CCCC1c1ccc(OC)cc1)C1CC1 |
| InChI | InChI=1S/C20H28N2O4/c1-3-26-20(24)14-21(16-8-9-16)13-19(23)22-12-4-5-18(22)15-6-10-17(25-2)11-7-15/h6-7,10-11,16,18H,3-5,8-9,12-14H2,1-2H3 |
| InChIKey | HBSAZLBSWNMROS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |