C16H23NO5 — CID 102567699
ethyl 2-[2-[(4-methoxyphenoxy)methyl]morpholin-4-yl]acetate (PubChem CID 102567699) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is ethyl 2-[2-[(4-methoxyphenoxy)methyl]morpholin-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(4-methoxyphenoxy)methyl]morpholin-4-yl]acetate |
|---|---|
| PubChem CID | 102567699 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | ethyl 2-[2-[(4-methoxyphenoxy)methyl]morpholin-4-yl]acetate |
| SMILES | CCOC(=O)CN1CCOC(COc2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C16H23NO5/c1-3-20-16(18)11-17-8-9-21-15(10-17)12-22-14-6-4-13(19-2)5-7-14/h4-7,15H,3,8-12H2,1-2H3 |
| InChIKey | WDISSMSIIAUDEN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |