C15H20FNO4 — CID 99979464
ethyl 2-[(2R)-2-[(4-fluorophenoxy)methyl]morpholin-4-yl]acetate (PubChem CID 99979464) has the molecular formula C15H20FNO4 and a molecular weight of 297.33 g/mol. Its IUPAC name is ethyl 2-[(2R)-2-[(4-fluorophenoxy)methyl]morpholin-4-yl]acetate.
| Compound Name | ethyl 2-[(2R)-2-[(4-fluorophenoxy)methyl]morpholin-4-yl]acetate |
|---|---|
| PubChem CID | 99979464 |
| Molecular Formula | C15H20FNO4 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | ethyl 2-[(2R)-2-[(4-fluorophenoxy)methyl]morpholin-4-yl]acetate |
| SMILES | CCOC(=O)CN1CCO[C@@H](COc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H20FNO4/c1-2-19-15(18)10-17-7-8-20-14(9-17)11-21-13-5-3-12(16)4-6-13/h3-6,14H,2,7-11H2,1H3/t14-/m1/s1 |
| InChIKey | RPBODZPCAKZQNT-CQSZACIVSA-N |
| XLogP | 1.47 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |