C14H20N2O4 — CID 99979589
2-[(2R)-2-[(2-methoxyphenoxy)methyl]morpholin-4-yl]acetamide (PubChem CID 99979589) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-[(2R)-2-[(2-methoxyphenoxy)methyl]morpholin-4-yl]acetamide.
| Compound Name | 2-[(2R)-2-[(2-methoxyphenoxy)methyl]morpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 99979589 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-[(2R)-2-[(2-methoxyphenoxy)methyl]morpholin-4-yl]acetamide |
| SMILES | COc1ccccc1OC[C@H]1CN(CC(N)=O)CCO1 |
| InChI | InChI=1S/C14H20N2O4/c1-18-12-4-2-3-5-13(12)20-10-11-8-16(6-7-19-11)9-14(15)17/h2-5,11H,6-10H2,1H3,(H2,15,17)/t11-/m1/s1 |
| InChIKey | YPTCXPIAAFSIEP-LLVKDONJSA-N |
| XLogP | 0.26 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |