C18H19ClN2O4 — CID 92758229
(2-chloro-3-pyridinyl)-[(2S)-2-[(2-methoxyphenoxy)methyl]morpholin-4-yl]methanone (PubChem CID 92758229) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)-[(2S)-2-[(2-methoxyphenoxy)methyl]morpholin-4-yl]methanone.
| Compound Name | (2-chloro-3-pyridinyl)-[(2S)-2-[(2-methoxyphenoxy)methyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 92758229 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (2-chloro-3-pyridinyl)-[(2S)-2-[(2-methoxyphenoxy)methyl]morpholin-4-yl]methanone |
| SMILES | COc1ccccc1OC[C@@H]1CN(C(=O)c2cccnc2Cl)CCO1 |
| InChI | InChI=1S/C18H19ClN2O4/c1-23-15-6-2-3-7-16(15)25-12-13-11-21(9-10-24-13)18(22)14-5-4-8-20-17(14)19/h2-8,13H,9-12H2,1H3/t13-/m0/s1 |
| InChIKey | ZBNPFXVFDWKEAV-ZDUSSCGKSA-N |
| XLogP | 2.66 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|