C19H21ClN4O5 — CID 3751246
1-[2-[(2-chloro-3-pyridinyl)oxymethyl]morpholin-4-yl]-3-(2,4-dimethoxypyrimidin-5-yl)prop-2-en-1-one (PubChem CID 3751246) has the molecular formula C19H21ClN4O5 and a molecular weight of 420.85 g/mol. Its IUPAC name is 1-[2-[(2-chloro-3-pyridinyl)oxymethyl]morpholin-4-yl]-3-(2,4-dimethoxypyrimidin-5-yl)prop-2-en-1-one.
| Compound Name | 1-[2-[(2-chloro-3-pyridinyl)oxymethyl]morpholin-4-yl]-3-(2,4-dimethoxypyrimidin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3751246 |
| Molecular Formula | C19H21ClN4O5 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 1-[2-[(2-chloro-3-pyridinyl)oxymethyl]morpholin-4-yl]-3-(2,4-dimethoxypyrimidin-5-yl)prop-2-en-1-one |
| SMILES | COc1ncc(C=CC(=O)N2CCOC(COc3cccnc3Cl)C2)c(OC)n1 |
| InChI | InChI=1S/C19H21ClN4O5/c1-26-18-13(10-22-19(23-18)27-2)5-6-16(25)24-8-9-28-14(11-24)12-29-15-4-3-7-21-17(15)20/h3-7,10,14H,8-9,11-12H2,1-2H3 |
| InChIKey | YDUPYTOXXOIUOO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 95.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|