C19H21ClNO5P — CID 22677724
2-[2-[4-(4-chlorophenoxy)phenyl]-4-methyl-2-oxo-1,3,2λ5-oxazaphosphepan-3-yl]acetic acid (PubChem CID 22677724) has the molecular formula C19H21ClNO5P and a molecular weight of 409.81 g/mol. Its IUPAC name is 2-[2-[4-(4-chlorophenoxy)phenyl]-4-methyl-2-oxo-1,3,2λ5-oxazaphosphepan-3-yl]acetic acid.
| Compound Name | 2-[2-[4-(4-chlorophenoxy)phenyl]-4-methyl-2-oxo-1,3,2λ5-oxazaphosphepan-3-yl]acetic acid |
|---|---|
| PubChem CID | 22677724 |
| Molecular Formula | C19H21ClNO5P |
| Molecular Weight | 409.81 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-[2-[4-(4-chlorophenoxy)phenyl]-4-methyl-2-oxo-1,3,2λ5-oxazaphosphepan-3-yl]acetic acid |
| SMILES | CC1CCCOP(=O)(c2ccc(Oc3ccc(Cl)cc3)cc2)N1CC(=O)O |
| InChI | InChI=1S/C19H21ClNO5P/c1-14-3-2-12-25-27(24,21(14)13-19(22)23)18-10-8-17(9-11-18)26-16-6-4-15(20)5-7-16/h4-11,14H,2-3,12-13H2,1H3,(H,22,23) |
| InChIKey | LTEJGXRFZHKRAE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.81 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|