C21H25ClNO5P — CID 91293813
methyl (2R)-2-[2-[4-(4-chlorophenoxy)phenyl]-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]pentanoate (PubChem CID 91293813) has the molecular formula C21H25ClNO5P and a molecular weight of 437.86 g/mol. Its IUPAC name is methyl (2R)-2-[2-[4-(4-chlorophenoxy)phenyl]-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]pentanoate.
| Compound Name | methyl (2R)-2-[2-[4-(4-chlorophenoxy)phenyl]-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]pentanoate |
|---|---|
| PubChem CID | 91293813 |
| Molecular Formula | C21H25ClNO5P |
| Molecular Weight | 437.86 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | methyl (2R)-2-[2-[4-(4-chlorophenoxy)phenyl]-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]pentanoate |
| SMILES | CCC[C@H](C(=O)OC)N1CCCOP1(=O)c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H25ClNO5P/c1-3-5-20(21(24)26-2)23-14-4-15-27-29(23,25)19-12-10-18(11-13-19)28-17-8-6-16(22)7-9-17/h6-13,20H,3-5,14-15H2,1-2H3/t20-,29?/m1/s1 |
| InChIKey | JCFNUOOSAJPHSR-CUXXENAFSA-N |
| XLogP | 5.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.86 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|