C16H24NO4P — CID 18630411
2-(2-oxo-2-phenyl-1,3,2lambda5-oxazaphosphepan-3-yl)hexanoic acid (PubChem CID 18630411) has the molecular formula C16H24NO4P and a molecular weight of 325.34 g/mol. Its IUPAC name is 2-(2-oxo-2-phenyl-1,3,2lambda5-oxazaphosphepan-3-yl)hexanoic acid.
| Compound Name | 2-(2-oxo-2-phenyl-1,3,2lambda5-oxazaphosphepan-3-yl)hexanoic acid |
|---|---|
| PubChem CID | 18630411 |
| Molecular Formula | C16H24NO4P |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-(2-oxo-2-phenyl-1,3,2lambda5-oxazaphosphepan-3-yl)hexanoic acid |
| SMILES | CCCCC(C(=O)O)N1CCCCOP1(=O)c1ccccc1 |
| InChI | InChI=1S/C16H24NO4P/c1-2-3-11-15(16(18)19)17-12-7-8-13-21-22(17,20)14-9-5-4-6-10-14/h4-6,9-10,15H,2-3,7-8,11-13H2,1H3,(H,18,19) |
| InChIKey | HSWHBQYMXOQKDX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|