methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate

C16H23NO2 — CID 112688849

IUPACmethyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate
SMILESCCCCC(C(=O)OC)N1CCc2ccccc2C1
InChIInChI=1S/C16H23NO2/c1-3-4-9-15(16(18)19-2)17-11-10-13-7-5-6-8-14(13)12-17/h5-8,15H,3-4,9-12H2,1-2H3
InChIKeyLGDRHNXRMCMPDL-UHFFFAOYSA-N
MW261.37 g/mol
LogP2.78
Rot. Bonds5

About methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate

methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate (PubChem CID 112688849) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate.

Molecular Properties

Compound Namemethyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate
PubChem CID112688849
Molecular FormulaC16H23NO2
Molecular Weight261.37 g/mol
Exact Mass261.17
IUPAC Namemethyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate
SMILESCCCCC(C(=O)OC)N1CCc2ccccc2C1
InChIInChI=1S/C16H23NO2/c1-3-4-9-15(16(18)19-2)17-11-10-13-7-5-6-8-14(13)12-17/h5-8,15H,3-4,9-12H2,1-2H3
InChIKeyLGDRHNXRMCMPDL-UHFFFAOYSA-N
XLogP2.78
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.37
LogP ≤ 52.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate?
The IUPAC name of methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate (CID 112688849) is methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate.
What is the SMILES notation for methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate?
The canonical SMILES for methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate is CCCCC(C(=O)OC)N1CCc2ccccc2C1.
What is the InChIKey of methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate?
The InChIKey is LGDRHNXRMCMPDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-3-4-9-15(16(18)19-2)17-11-10-13-7-5-6-8-14(13)12-17/h5-8,15H,3-4,9-12H2,1-2H3.
What are the key properties of methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate?
methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate has a molecular weight of 261.37 g/mol, XLogP of 2.78, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4-dihydro-1H-isoquinolin-2-yl)hexanoate is sourced from PubChem (CID 112688849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).