C19H22N2O — CID 82256537
1-(4-aminophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one (PubChem CID 82256537) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one.
| Compound Name | 1-(4-aminophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one |
|---|---|
| PubChem CID | 82256537 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-(4-aminophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one |
| SMILES | CCC(C(=O)c1ccc(N)cc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H22N2O/c1-2-18(19(22)15-7-9-17(20)10-8-15)21-12-11-14-5-3-4-6-16(14)13-21/h3-10,18H,2,11-13,20H2,1H3 |
| InChIKey | VEGGRVQDLCJCAD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|