C13H17NO2 — CID 51886799
methyl (2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate (PubChem CID 51886799) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is methyl (2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate.
| Compound Name | methyl (2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate |
|---|---|
| PubChem CID | 51886799 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | methyl (2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate |
| SMILES | COC(=O)[C@H](C)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H17NO2/c1-10(13(15)16-2)14-8-7-11-5-3-4-6-12(11)9-14/h3-6,10H,7-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | TXWIBOZDZCOFBL-JTQLQIEISA-N |
| XLogP | 1.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |