methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate

C14H19NO2 — CID 82582376

IUPACmethyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate
SMILESCOC(=O)C(C)N1CCc2ccc(C)cc2C1
InChIInChI=1S/C14H19NO2/c1-10-4-5-12-6-7-15(9-13(12)8-10)11(2)14(16)17-3/h4-5,8,11H,6-7,9H2,1-3H3
InChIKeyPUYODBMKIRYLDW-UHFFFAOYSA-N
MW233.31 g/mol
LogP1.91
Rot. Bonds2

About methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate

methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate (PubChem CID 82582376) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate
PubChem CID82582376
Molecular FormulaC14H19NO2
Molecular Weight233.31 g/mol
Exact Mass233.14
IUPAC Namemethyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate
SMILESCOC(=O)C(C)N1CCc2ccc(C)cc2C1
InChIInChI=1S/C14H19NO2/c1-10-4-5-12-6-7-15(9-13(12)8-10)11(2)14(16)17-3/h4-5,8,11H,6-7,9H2,1-3H3
InChIKeyPUYODBMKIRYLDW-UHFFFAOYSA-N
XLogP1.91
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.31
LogP ≤ 51.91
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate?
The IUPAC name of methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate (CID 82582376) is methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate.
What is the SMILES notation for methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate?
The canonical SMILES for methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate is COC(=O)C(C)N1CCc2ccc(C)cc2C1.
What is the InChIKey of methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate?
The InChIKey is PUYODBMKIRYLDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-10-4-5-12-6-7-15(9-13(12)8-10)11(2)14(16)17-3/h4-5,8,11H,6-7,9H2,1-3H3.
What are the key properties of methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate?
methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate has a molecular weight of 233.31 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)propanoate is sourced from PubChem (CID 82582376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).