C14H20N2S — CID 63153096
2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)butanethioamide (PubChem CID 63153096) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)butanethioamide.
| Compound Name | 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)butanethioamide |
|---|---|
| PubChem CID | 63153096 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)butanethioamide |
| SMILES | CCC(C(N)=S)N1CCCc2ccccc2C1 |
| InChI | InChI=1S/C14H20N2S/c1-2-13(14(15)17)16-9-5-8-11-6-3-4-7-12(11)10-16/h3-4,6-7,13H,2,5,8-10H2,1H3,(H2,15,17) |
| InChIKey | IVEHJCSAAAFYGR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|