C13H18N2S — CID 63152920
3-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propanethioamide (PubChem CID 63152920) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 3-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propanethioamide.
| Compound Name | 3-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propanethioamide |
|---|---|
| PubChem CID | 63152920 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 3-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propanethioamide |
| SMILES | NC(=S)CCN1CCCc2ccccc2C1 |
| InChI | InChI=1S/C13H18N2S/c14-13(16)7-9-15-8-3-6-11-4-1-2-5-12(11)10-15/h1-2,4-5H,3,6-10H2,(H2,14,16) |
| InChIKey | FJYIWQIDCLHIRX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|