C17H27N3O — CID 63152637
2-amino-2-methyl-6-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)hexanamide (PubChem CID 63152637) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-amino-2-methyl-6-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)hexanamide.
| Compound Name | 2-amino-2-methyl-6-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)hexanamide |
|---|---|
| PubChem CID | 63152637 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 2-amino-2-methyl-6-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)hexanamide |
| SMILES | CC(N)(CCCCN1CCCc2ccccc2C1)C(N)=O |
| InChI | InChI=1S/C17H27N3O/c1-17(19,16(18)21)10-4-5-11-20-12-6-9-14-7-2-3-8-15(14)13-20/h2-3,7-8H,4-6,9-13,19H2,1H3,(H2,18,21) |
| InChIKey | GKAQLNCCBVRNDR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|