C15H24N2O — CID 64786644
2-amino-6-(1,3-dihydroisoindol-2-yl)-2-methylhexan-1-ol (PubChem CID 64786644) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-amino-6-(1,3-dihydroisoindol-2-yl)-2-methylhexan-1-ol.
| Compound Name | 2-amino-6-(1,3-dihydroisoindol-2-yl)-2-methylhexan-1-ol |
|---|---|
| PubChem CID | 64786644 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2-amino-6-(1,3-dihydroisoindol-2-yl)-2-methylhexan-1-ol |
| SMILES | CC(N)(CO)CCCCN1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H24N2O/c1-15(16,12-18)8-4-5-9-17-10-13-6-2-3-7-14(13)11-17/h2-3,6-7,18H,4-5,8-12,16H2,1H3 |
| InChIKey | LFCYQSHFMWQLKR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|