C12H18N2 — CID 62205174
4-(1,3-dihydroisoindol-2-yl)butan-1-amine (PubChem CID 62205174) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-(1,3-dihydroisoindol-2-yl)butan-1-amine.
| Compound Name | 4-(1,3-dihydroisoindol-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 62205174 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-(1,3-dihydroisoindol-2-yl)butan-1-amine |
| SMILES | NCCCCN1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H18N2/c13-7-3-4-8-14-9-11-5-1-2-6-12(11)10-14/h1-2,5-6H,3-4,7-10,13H2 |
| InChIKey | WRXRCHCRYZOLLB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|