C14H21N3O — CID 55165611
2-amino-4-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)butanamide (PubChem CID 55165611) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-amino-4-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)butanamide.
| Compound Name | 2-amino-4-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)butanamide |
|---|---|
| PubChem CID | 55165611 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2-amino-4-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)butanamide |
| SMILES | NC(=O)C(N)CCN1CCCc2ccccc2C1 |
| InChI | InChI=1S/C14H21N3O/c15-13(14(16)18)7-9-17-8-3-6-11-4-1-2-5-12(11)10-17/h1-2,4-5,13H,3,6-10,15H2,(H2,16,18) |
| InChIKey | XJZDAEPPFFPWIY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |