C15H23N3O — CID 55213456
5-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)pentanehydrazide (PubChem CID 55213456) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 5-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)pentanehydrazide.
| Compound Name | 5-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)pentanehydrazide |
|---|---|
| PubChem CID | 55213456 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 5-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)pentanehydrazide |
| SMILES | NNC(=O)CCCCN1CCCc2ccccc2C1 |
| InChI | InChI=1S/C15H23N3O/c16-17-15(19)9-3-4-10-18-11-5-8-13-6-1-2-7-14(13)12-18/h1-2,6-7H,3-5,8-12,16H2,(H,17,19) |
| InChIKey | YGHIYUACKCCPID-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|