C11H15N3O — CID 63572405
3-(1,3-dihydroisoindol-2-yl)propanehydrazide (PubChem CID 63572405) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-(1,3-dihydroisoindol-2-yl)propanehydrazide.
| Compound Name | 3-(1,3-dihydroisoindol-2-yl)propanehydrazide |
|---|---|
| PubChem CID | 63572405 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 3-(1,3-dihydroisoindol-2-yl)propanehydrazide |
| SMILES | NNC(=O)CCN1Cc2ccccc2C1 |
| InChI | InChI=1S/C11H15N3O/c12-13-11(15)5-6-14-7-9-3-1-2-4-10(9)8-14/h1-4H,5-8,12H2,(H,13,15) |
| InChIKey | BLFHQBDBNWFKEN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|