C7H12N4O3 — CID 66061045
3-(3,5-dioxopiperazin-1-yl)propanehydrazide (PubChem CID 66061045) has the molecular formula C7H12N4O3 and a molecular weight of 200.20 g/mol. Its IUPAC name is 3-(3,5-dioxopiperazin-1-yl)propanehydrazide.
| Compound Name | 3-(3,5-dioxopiperazin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 66061045 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 3-(3,5-dioxopiperazin-1-yl)propanehydrazide |
| SMILES | NNC(=O)CCN1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C7H12N4O3/c8-10-5(12)1-2-11-3-6(13)9-7(14)4-11/h1-4,8H2,(H,10,12)(H,9,13,14) |
| InChIKey | VEYFYHNPSYCXLI-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|