C15H23ClN2O — CID 21092218
6-(3,4-dihydro-1H-isoquinolin-2-yl)hexanamide;hydrochloride (PubChem CID 21092218) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is 6-(3,4-dihydro-1H-isoquinolin-2-yl)hexanamide;hydrochloride.
| Compound Name | 6-(3,4-dihydro-1H-isoquinolin-2-yl)hexanamide;hydrochloride |
|---|---|
| PubChem CID | 21092218 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 6-(3,4-dihydro-1H-isoquinolin-2-yl)hexanamide;hydrochloride |
| SMILES | Cl.NC(=O)CCCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H22N2O.ClH/c16-15(18)8-2-1-5-10-17-11-9-13-6-3-4-7-14(13)12-17;/h3-4,6-7H,1-2,5,8-12H2,(H2,16,18);1H |
| InChIKey | NPIKRPXHAXNEHJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|