C12H24N4O2 — CID 102892888
6-(4-methyl-3-oxo-1,4-diazepan-1-yl)hexanehydrazide (PubChem CID 102892888) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 6-(4-methyl-3-oxo-1,4-diazepan-1-yl)hexanehydrazide.
| Compound Name | 6-(4-methyl-3-oxo-1,4-diazepan-1-yl)hexanehydrazide |
|---|---|
| PubChem CID | 102892888 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 6-(4-methyl-3-oxo-1,4-diazepan-1-yl)hexanehydrazide |
| SMILES | CN1CCCN(CCCCCC(=O)NN)CC1=O |
| InChI | InChI=1S/C12H24N4O2/c1-15-7-5-9-16(10-12(15)18)8-4-2-3-6-11(17)14-13/h2-10,13H2,1H3,(H,14,17) |
| InChIKey | ZFWBQICQYHBFFN-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|