C11H20N2O3 — CID 102889464
5-(4-methyl-3-oxo-1,4-diazepan-1-yl)pentanoic acid (PubChem CID 102889464) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 5-(4-methyl-3-oxo-1,4-diazepan-1-yl)pentanoic acid.
| Compound Name | 5-(4-methyl-3-oxo-1,4-diazepan-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 102889464 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 5-(4-methyl-3-oxo-1,4-diazepan-1-yl)pentanoic acid |
| SMILES | CN1CCCN(CCCCC(=O)O)CC1=O |
| InChI | InChI=1S/C11H20N2O3/c1-12-6-4-8-13(9-10(12)14)7-3-2-5-11(15)16/h2-9H2,1H3,(H,15,16) |
| InChIKey | YTTULAWYRCEIHU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|