5-(1,4-diazepan-1-yl)pentanoic acid

C10H20N2O2 — CID 61397954

IUPAC5-(1,4-diazepan-1-yl)pentanoic acid
SMILESO=C(O)CCCCN1CCCNCC1
InChIInChI=1S/C10H20N2O2/c13-10(14)4-1-2-7-12-8-3-5-11-6-9-12/h11H,1-9H2,(H,13,14)
InChIKeyQSBORMXKCCVGNM-UHFFFAOYSA-N
MW200.28 g/mol
LogP0.54
Rot. Bonds5

About 5-(1,4-diazepan-1-yl)pentanoic acid

5-(1,4-diazepan-1-yl)pentanoic acid (PubChem CID 61397954) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)pentanoic acid.

Molecular Properties

Compound Name5-(1,4-diazepan-1-yl)pentanoic acid
PubChem CID61397954
Molecular FormulaC10H20N2O2
Molecular Weight200.28 g/mol
Exact Mass200.15
IUPAC Name5-(1,4-diazepan-1-yl)pentanoic acid
SMILESO=C(O)CCCCN1CCCNCC1
InChIInChI=1S/C10H20N2O2/c13-10(14)4-1-2-7-12-8-3-5-11-6-9-12/h11H,1-9H2,(H,13,14)
InChIKeyQSBORMXKCCVGNM-UHFFFAOYSA-N
XLogP0.54
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.28
LogP ≤ 50.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(1,4-diazepan-1-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,4-diazepan-1-yl)pentanoic acid?
The IUPAC name of 5-(1,4-diazepan-1-yl)pentanoic acid (CID 61397954) is 5-(1,4-diazepan-1-yl)pentanoic acid.
What is the SMILES notation for 5-(1,4-diazepan-1-yl)pentanoic acid?
The canonical SMILES for 5-(1,4-diazepan-1-yl)pentanoic acid is O=C(O)CCCCN1CCCNCC1.
What is the InChIKey of 5-(1,4-diazepan-1-yl)pentanoic acid?
The InChIKey is QSBORMXKCCVGNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c13-10(14)4-1-2-7-12-8-3-5-11-6-9-12/h11H,1-9H2,(H,13,14).
What are the key properties of 5-(1,4-diazepan-1-yl)pentanoic acid?
5-(1,4-diazepan-1-yl)pentanoic acid has a molecular weight of 200.28 g/mol, XLogP of 0.54, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,4-diazepan-1-yl)pentanoic acid is sourced from PubChem (CID 61397954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).