3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid

C13H29N5O2 — CID 21338288

IUPAC3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid
SMILESO=C(O)CCN1CCNCCNCCNCCNCC1
InChIInChI=1S/C13H29N5O2/c19-13(20)1-10-18-11-8-16-6-4-14-2-3-15-5-7-17-9-12-18/h14-17H,1-12H2,(H,19,20)
InChIKeyFWIIVONKOHTEAA-UHFFFAOYSA-N
MW287.41 g/mol
LogP-1.86
Rot. Bonds3

About 3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid

3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid (PubChem CID 21338288) has the molecular formula C13H29N5O2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid.

Molecular Properties

Compound Name3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid
PubChem CID21338288
Molecular FormulaC13H29N5O2
Molecular Weight287.41 g/mol
Exact Mass287.23
IUPAC Name3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid
SMILESO=C(O)CCN1CCNCCNCCNCCNCC1
InChIInChI=1S/C13H29N5O2/c19-13(20)1-10-18-11-8-16-6-4-14-2-3-15-5-7-17-9-12-18/h14-17H,1-12H2,(H,19,20)
InChIKeyFWIIVONKOHTEAA-UHFFFAOYSA-N
XLogP-1.86
TPSA88.66 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.41
LogP ≤ 5-1.86
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Analyze 3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid?
The IUPAC name of 3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid (CID 21338288) is 3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid.
What is the SMILES notation for 3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid?
The canonical SMILES for 3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid is O=C(O)CCN1CCNCCNCCNCCNCC1.
What is the InChIKey of 3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid?
The InChIKey is FWIIVONKOHTEAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N5O2/c19-13(20)1-10-18-11-8-16-6-4-14-2-3-15-5-7-17-9-12-18/h14-17H,1-12H2,(H,19,20).
What are the key properties of 3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid?
3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid has a molecular weight of 287.41 g/mol, XLogP of -1.86, 3 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4,7,10,13-pentazacyclopentadec-1-yl)propanoic acid is sourced from PubChem (CID 21338288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).