hydrazine;3-piperidin-1-ylpropanoic acid

C8H19N3O2 — CID 161275938

IUPAChydrazine;3-piperidin-1-ylpropanoic acid
SMILESNN.O=C(O)CCN1CCCCC1
InChIInChI=1S/C8H15NO2.H4N2/c10-8(11)4-7-9-5-2-1-3-6-9;1-2/h1-7H2,(H,10,11);1-2H2
InChIKeyVELBIFJQRHUNNJ-UHFFFAOYSA-N
MW189.26 g/mol
LogP-0.23
Rot. Bonds3

About hydrazine;3-piperidin-1-ylpropanoic acid

hydrazine;3-piperidin-1-ylpropanoic acid (PubChem CID 161275938) has the molecular formula C8H19N3O2 and a molecular weight of 189.26 g/mol. Its IUPAC name is hydrazine;3-piperidin-1-ylpropanoic acid.

Molecular Properties

Compound Namehydrazine;3-piperidin-1-ylpropanoic acid
PubChem CID161275938
Molecular FormulaC8H19N3O2
Molecular Weight189.26 g/mol
Exact Mass189.15
IUPAC Namehydrazine;3-piperidin-1-ylpropanoic acid
SMILESNN.O=C(O)CCN1CCCCC1
InChIInChI=1S/C8H15NO2.H4N2/c10-8(11)4-7-9-5-2-1-3-6-9;1-2/h1-7H2,(H,10,11);1-2H2
InChIKeyVELBIFJQRHUNNJ-UHFFFAOYSA-N
XLogP-0.23
TPSA92.58 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.26
LogP ≤ 5-0.23
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze hydrazine;3-piperidin-1-ylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1-Piperidinepropanoic acid
CID 117782
3-(Piperidin-1-yl)propanoic acid hydrochloride
CID 13131921
3-(1-Methylpiperidin-1-ium-1-yl)propanoic acid
CID 21578856
3-Piperidin-1-ylpropanoic acid;ZINC
CID 70301756
3-(1-Ethylpiperidin-1-ium-1-yl)propanoic acid
CID 117676477
3-(1-Methylpiperidin-1-ium-1-yl)propanoic acid hydroxide
CID 140077824
3-Piperidin-1-ylpropanoic acid;dihydrate
CID 141811835
3-Piperidin-1-ylpropanoic acid;hydrate
CID 160136597
3-(1-Methylpiperidin-1-ium-1-yl)propanoic acid bromide
CID 175187891
3-(1-Aminopiperidin-1-ium-1-yl)propanoate
CID 12276930
3-(1-Aminopiperidin-1-ium-1-yl)propanoic acid
CID 12276931
3-Piperidin-1-ylpropanoic acid chloride
CID 21178457

Frequently Asked Questions

What is the IUPAC name of hydrazine;3-piperidin-1-ylpropanoic acid?
The IUPAC name of hydrazine;3-piperidin-1-ylpropanoic acid (CID 161275938) is hydrazine;3-piperidin-1-ylpropanoic acid.
What is the SMILES notation for hydrazine;3-piperidin-1-ylpropanoic acid?
The canonical SMILES for hydrazine;3-piperidin-1-ylpropanoic acid is NN.O=C(O)CCN1CCCCC1.
What is the InChIKey of hydrazine;3-piperidin-1-ylpropanoic acid?
The InChIKey is VELBIFJQRHUNNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.H4N2/c10-8(11)4-7-9-5-2-1-3-6-9;1-2/h1-7H2,(H,10,11);1-2H2.
What are the key properties of hydrazine;3-piperidin-1-ylpropanoic acid?
hydrazine;3-piperidin-1-ylpropanoic acid has a molecular weight of 189.26 g/mol, XLogP of -0.23, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;3-piperidin-1-ylpropanoic acid is sourced from PubChem (CID 161275938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).