C8H15NO2S — CID 61419192
3-(1,4-thiazepan-4-yl)propanoic acid (PubChem CID 61419192) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is 3-(1,4-thiazepan-4-yl)propanoic acid.
| Compound Name | 3-(1,4-thiazepan-4-yl)propanoic acid |
|---|---|
| PubChem CID | 61419192 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 3-(1,4-thiazepan-4-yl)propanoic acid |
| SMILES | O=C(O)CCN1CCCSCC1 |
| InChI | InChI=1S/C8H15NO2S/c10-8(11)2-4-9-3-1-6-12-7-5-9/h1-7H2,(H,10,11) |
| InChIKey | UWHJIRCGVIXQMY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |