C14H24N2O2 — CID 3628395
1,6-dipyrrolidin-1-ylhexane-3,4-dione (PubChem CID 3628395) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1,6-dipyrrolidin-1-ylhexane-3,4-dione.
| Compound Name | 1,6-dipyrrolidin-1-ylhexane-3,4-dione |
|---|---|
| PubChem CID | 3628395 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 1,6-dipyrrolidin-1-ylhexane-3,4-dione |
| SMILES | O=C(CCN1CCCC1)C(=O)CCN1CCCC1 |
| InChI | InChI=1S/C14H24N2O2/c17-13(5-11-15-7-1-2-8-15)14(18)6-12-16-9-3-4-10-16/h1-12H2 |
| InChIKey | ZJPVDHKLHFRQHC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|