C12H22N4O3 — CID 61405185
3-[4-(piperazine-1-carbonyl)piperazin-1-yl]propanoic acid (PubChem CID 61405185) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-[4-(piperazine-1-carbonyl)piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-(piperazine-1-carbonyl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 61405185 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 3-[4-(piperazine-1-carbonyl)piperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCN(C(=O)N2CCNCC2)CC1 |
| InChI | InChI=1S/C12H22N4O3/c17-11(18)1-4-14-7-9-16(10-8-14)12(19)15-5-2-13-3-6-15/h13H,1-10H2,(H,17,18) |
| InChIKey | KWCYKMQUAFFXJM-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |