C14H28N6O6 — CID 174927444
butanedioic acid;bis(piperazine-1-carboxamide) (PubChem CID 174927444) has the molecular formula C14H28N6O6 and a molecular weight of 376.41 g/mol. Its IUPAC name is butanedioic acid;bis(piperazine-1-carboxamide).
| Compound Name | butanedioic acid;bis(piperazine-1-carboxamide) |
|---|---|
| PubChem CID | 174927444 |
| Molecular Formula | C14H28N6O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | butanedioic acid;bis(piperazine-1-carboxamide) |
| SMILES | NC(=O)N1CCNCC1.NC(=O)N1CCNCC1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/2C5H11N3O.C4H6O4/c2*6-5(9)8-3-1-7-2-4-8;5-3(6)1-2-4(7)8/h2*7H,1-4H2,(H2,6,9);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | MWGFRKMPQISGJT-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 191.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |