About 4-hydroxypiperidine-1-carboxamide;piperidin-4-ol
4-hydroxypiperidine-1-carboxamide;piperidin-4-ol (PubChem CID 158744315) has the molecular formula C11H23N3O3
and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-hydroxypiperidine-1-carboxamide;piperidin-4-ol.
Molecular Properties
| Compound Name | 4-hydroxypiperidine-1-carboxamide;piperidin-4-ol |
| PubChem CID | 158744315 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | 4-hydroxypiperidine-1-carboxamide;piperidin-4-ol |
| SMILES | NC(=O)N1CCC(O)CC1.OC1CCNCC1 |
| InChI | InChI=1S/C6H12N2O2.C5H11NO/c7-6(10)8-3-1-5(9)2-4-8;7-5-1-3-6-4-2-5/h5,9H,1-4H2,(H2,7,10);5-7H,1-4H2 |
| InChIKey | IMRPDLMFAUEFMM-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxypiperidine-1-carboxamide;piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxypiperidine-1-carboxamide;piperidin-4-ol?
The IUPAC name of 4-hydroxypiperidine-1-carboxamide;piperidin-4-ol (CID 158744315) is 4-hydroxypiperidine-1-carboxamide;piperidin-4-ol.
What is the SMILES notation for 4-hydroxypiperidine-1-carboxamide;piperidin-4-ol?
The canonical SMILES for 4-hydroxypiperidine-1-carboxamide;piperidin-4-ol is NC(=O)N1CCC(O)CC1.OC1CCNCC1.
What is the InChIKey of 4-hydroxypiperidine-1-carboxamide;piperidin-4-ol?
The InChIKey is IMRPDLMFAUEFMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2.C5H11NO/c7-6(10)8-3-1-5(9)2-4-8;7-5-1-3-6-4-2-5/h5,9H,1-4H2,(H2,7,10);5-7H,1-4H2.
What are the key properties of 4-hydroxypiperidine-1-carboxamide;piperidin-4-ol?
4-hydroxypiperidine-1-carboxamide;piperidin-4-ol has a molecular weight of 245.32 g/mol, XLogP of -0.75, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxypiperidine-1-carboxamide;piperidin-4-ol is sourced from PubChem (CID 158744315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).