About 1,7-diazacyclopentadecane-4,10,13-triol
1,7-diazacyclopentadecane-4,10,13-triol (PubChem CID 174313060) has the molecular formula C13H28N2O3
and a molecular weight of 260.38 g/mol. Its IUPAC name is 1,7-diazacyclopentadecane-4,10,13-triol.
Molecular Properties
| Compound Name | 1,7-diazacyclopentadecane-4,10,13-triol |
| PubChem CID | 174313060 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 1,7-diazacyclopentadecane-4,10,13-triol |
| SMILES | OC1CCNCCC(O)CCC(O)CCNCC1 |
| InChI | InChI=1S/C13H28N2O3/c16-11-1-2-12(17)4-8-15-10-6-13(18)5-9-14-7-3-11/h11-18H,1-10H2 |
| InChIKey | HXFYNECCOZMFPT-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,7-diazacyclopentadecane-4,10,13-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-diazacyclopentadecane-4,10,13-triol?
The IUPAC name of 1,7-diazacyclopentadecane-4,10,13-triol (CID 174313060) is 1,7-diazacyclopentadecane-4,10,13-triol.
What is the SMILES notation for 1,7-diazacyclopentadecane-4,10,13-triol?
The canonical SMILES for 1,7-diazacyclopentadecane-4,10,13-triol is OC1CCNCCC(O)CCC(O)CCNCC1.
What is the InChIKey of 1,7-diazacyclopentadecane-4,10,13-triol?
The InChIKey is HXFYNECCOZMFPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O3/c16-11-1-2-12(17)4-8-15-10-6-13(18)5-9-14-7-3-11/h11-18H,1-10H2.
What are the key properties of 1,7-diazacyclopentadecane-4,10,13-triol?
1,7-diazacyclopentadecane-4,10,13-triol has a molecular weight of 260.38 g/mol, XLogP of -0.40, 0 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-diazacyclopentadecane-4,10,13-triol is sourced from PubChem (CID 174313060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).