About cyclohexane-1,4-diol;hydrochloride
cyclohexane-1,4-diol;hydrochloride (PubChem CID 141062883) has the molecular formula C6H13ClO2
and a molecular weight of 152.62 g/mol. Its IUPAC name is cyclohexane-1,4-diol;hydrochloride.
Molecular Properties
| Compound Name | cyclohexane-1,4-diol;hydrochloride |
| PubChem CID | 141062883 |
| Molecular Formula | C6H13ClO2 |
| Molecular Weight | 152.62 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | cyclohexane-1,4-diol;hydrochloride |
| SMILES | Cl.OC1CCC(O)CC1 |
| InChI | InChI=1S/C6H12O2.ClH/c7-5-1-2-6(8)4-3-5;/h5-8H,1-4H2;1H |
| InChIKey | VGAUFKJKTDRLBC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.62 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexane-1,4-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,4-diol;hydrochloride?
The IUPAC name of cyclohexane-1,4-diol;hydrochloride (CID 141062883) is cyclohexane-1,4-diol;hydrochloride.
What is the SMILES notation for cyclohexane-1,4-diol;hydrochloride?
The canonical SMILES for cyclohexane-1,4-diol;hydrochloride is Cl.OC1CCC(O)CC1.
What is the InChIKey of cyclohexane-1,4-diol;hydrochloride?
The InChIKey is VGAUFKJKTDRLBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.ClH/c7-5-1-2-6(8)4-3-5;/h5-8H,1-4H2;1H.
What are the key properties of cyclohexane-1,4-diol;hydrochloride?
cyclohexane-1,4-diol;hydrochloride has a molecular weight of 152.62 g/mol, XLogP of 0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,4-diol;hydrochloride is sourced from PubChem (CID 141062883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).