C6H13NO — CID 172990620
4-amino(1,2,3,4,5,6-13C6)cyclohexan-1-ol (PubChem CID 172990620) has the molecular formula C6H13NO and a molecular weight of 121.13 g/mol. Its IUPAC name is 4-amino(1,2,3,4,5,6-13C6)cyclohexan-1-ol.
| Compound Name | 4-amino(1,2,3,4,5,6-13C6)cyclohexan-1-ol |
|---|---|
| PubChem CID | 172990620 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 121.13 g/mol |
| Exact Mass | 121.12 |
| IUPAC Name | 4-amino(1,2,3,4,5,6-13C6)cyclohexan-1-ol |
| SMILES | N[13CH]1[13CH2][13CH2][13CH](O)[13CH2][13CH2]1 |
| InChI | InChI=1S/C6H13NO/c7-5-1-3-6(8)4-2-5/h5-6,8H,1-4,7H2/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | IMLXLGZJLAOKJN-IDEBNGHGSA-N |
| XLogP | 0.25 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.13 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |